C20H14I2N2O4S — CID 4989145
ethyl 4-cyano-5-[3-cyano-4-(4-hydroxy-3,5-diiodophenyl)-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate (PubChem CID 4989145) has the molecular formula C20H14I2N2O4S and a molecular weight of 632.22 g/mol. Its IUPAC name is ethyl 4-cyano-5-[3-cyano-4-(4-hydroxy-3,5-diiodophenyl)-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-5-[3-cyano-4-(4-hydroxy-3,5-diiodophenyl)-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 4989145 |
| Molecular Formula | C20H14I2N2O4S |
| Molecular Weight | 632.22 g/mol |
| Exact Mass | 631.88 |
| IUPAC Name | ethyl 4-cyano-5-[3-cyano-4-(4-hydroxy-3,5-diiodophenyl)-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(CC(=O)C(C#N)=Cc2cc(I)c(O)c(I)c2)c(C#N)c1C |
| InChI | InChI=1S/C20H14I2N2O4S/c1-3-28-20(27)19-10(2)13(9-24)17(29-19)7-16(25)12(8-23)4-11-5-14(21)18(26)15(22)6-11/h4-6,26H,3,7H2,1-2H3 |
| InChIKey | KAHVWKOMQBOQMO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.22 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|