C24H16FN3O6S — CID 6035253
ethyl 4-cyano-5-[(E)-3-cyano-4-[5-(4-fluoro-3-nitrophenyl)furan-2-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate (PubChem CID 6035253) has the molecular formula C24H16FN3O6S and a molecular weight of 493.47 g/mol. Its IUPAC name is ethyl 4-cyano-5-[(E)-3-cyano-4-[5-(4-fluoro-3-nitrophenyl)furan-2-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-5-[(E)-3-cyano-4-[5-(4-fluoro-3-nitrophenyl)furan-2-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 6035253 |
| Molecular Formula | C24H16FN3O6S |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | ethyl 4-cyano-5-[(E)-3-cyano-4-[5-(4-fluoro-3-nitrophenyl)furan-2-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(CC(=O)/C(C#N)=C/c2ccc(-c3ccc(F)c([N+](=O)[O-])c3)o2)c(C#N)c1C |
| InChI | InChI=1S/C24H16FN3O6S/c1-3-33-24(30)23-13(2)17(12-27)22(35-23)10-20(29)15(11-26)8-16-5-7-21(34-16)14-4-6-18(25)19(9-14)28(31)32/h4-9H,3,10H2,1-2H3/b15-8+ |
| InChIKey | SJRUNYYCKQTQNY-OVCLIPMQSA-N |
| XLogP | 5.13 |
| TPSA | 147.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|