C27H18FN3O6S — CID 3285990
ethyl 2-[[2-cyano-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 3285990) has the molecular formula C27H18FN3O6S and a molecular weight of 531.52 g/mol. Its IUPAC name is ethyl 2-[[2-cyano-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-cyano-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3285990 |
| Molecular Formula | C27H18FN3O6S |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | ethyl 2-[[2-cyano-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)C(C#N)=Cc1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C27H18FN3O6S/c1-2-36-27(33)24-22(16-3-7-19(28)8-4-16)15-38-26(24)30-25(32)18(14-29)13-21-11-12-23(37-21)17-5-9-20(10-6-17)31(34)35/h3-13,15H,2H2,1H3,(H,30,32) |
| InChIKey | YGYGUTJLTNPRAW-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 135.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|