C26H23FN2O4S — CID 1386395
ethyl (6S)-2-[[(E)-2-cyano-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 1386395) has the molecular formula C26H23FN2O4S and a molecular weight of 478.55 g/mol. Its IUPAC name is ethyl (6S)-2-[[(E)-2-cyano-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (6S)-2-[[(E)-2-cyano-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 1386395 |
| Molecular Formula | C26H23FN2O4S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | ethyl (6S)-2-[[(E)-2-cyano-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2ccc(-c3ccc(F)cc3)o2)sc2c1CC[C@H](C)C2 |
| InChI | InChI=1S/C26H23FN2O4S/c1-3-32-26(31)23-20-10-4-15(2)12-22(20)34-25(23)29-24(30)17(14-28)13-19-9-11-21(33-19)16-5-7-18(27)8-6-16/h5-9,11,13,15H,3-4,10,12H2,1-2H3,(H,29,30)/b17-13+/t15-/m0/s1 |
| InChIKey | KXYWKKQGFRNSRN-XOAFGZPJSA-N |
| XLogP | 5.99 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|