C24H20BrN3O3S — CID 3788069
2-[[3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 3788069) has the molecular formula C24H20BrN3O3S and a molecular weight of 510.41 g/mol. Its IUPAC name is 2-[[3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 3788069 |
| Molecular Formula | C24H20BrN3O3S |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 2-[[3-[5-(4-bromophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1CCc2c(sc(NC(=O)C(C#N)=Cc3ccc(-c4ccc(Br)cc4)o3)c2C(N)=O)C1 |
| InChI | InChI=1S/C24H20BrN3O3S/c1-13-2-8-18-20(10-13)32-24(21(18)22(27)29)28-23(30)15(12-26)11-17-7-9-19(31-17)14-3-5-16(25)6-4-14/h3-7,9,11,13H,2,8,10H2,1H3,(H2,27,29)(H,28,30) |
| InChIKey | QKJSKFUCAXEKTM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|