C23H16ClN3O5S — CID 2793690
ethyl 2-[[3-(4-chlorophenyl)-2-cyanoprop-2-enoyl]amino]-4-(4-nitrophenyl)thiophene-3-carboxylate (PubChem CID 2793690) has the molecular formula C23H16ClN3O5S and a molecular weight of 481.92 g/mol. Its IUPAC name is ethyl 2-[[3-(4-chlorophenyl)-2-cyanoprop-2-enoyl]amino]-4-(4-nitrophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3-(4-chlorophenyl)-2-cyanoprop-2-enoyl]amino]-4-(4-nitrophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2793690 |
| Molecular Formula | C23H16ClN3O5S |
| Molecular Weight | 481.92 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | ethyl 2-[[3-(4-chlorophenyl)-2-cyanoprop-2-enoyl]amino]-4-(4-nitrophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc([N+](=O)[O-])cc2)csc1NC(=O)C(C#N)=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16ClN3O5S/c1-2-32-23(29)20-19(15-5-9-18(10-6-15)27(30)31)13-33-22(20)26-21(28)16(12-25)11-14-3-7-17(24)8-4-14/h3-11,13H,2H2,1H3,(H,26,28) |
| InChIKey | CISAYMMCPKFWJL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.92 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|