C23H16BrClN2O4S — CID 3826310
ethyl 2-[[3-(5-bromo-2-hydroxyphenyl)-2-cyanoprop-2-enoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylate (PubChem CID 3826310) has the molecular formula C23H16BrClN2O4S and a molecular weight of 531.82 g/mol. Its IUPAC name is ethyl 2-[[3-(5-bromo-2-hydroxyphenyl)-2-cyanoprop-2-enoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3-(5-bromo-2-hydroxyphenyl)-2-cyanoprop-2-enoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3826310 |
| Molecular Formula | C23H16BrClN2O4S |
| Molecular Weight | 531.82 g/mol |
| Exact Mass | 529.97 |
| IUPAC Name | ethyl 2-[[3-(5-bromo-2-hydroxyphenyl)-2-cyanoprop-2-enoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)C(C#N)=Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C23H16BrClN2O4S/c1-2-31-23(30)20-18(13-3-6-17(25)7-4-13)12-32-22(20)27-21(29)15(11-26)9-14-10-16(24)5-8-19(14)28/h3-10,12,28H,2H2,1H3,(H,27,29) |
| InChIKey | OFXNLWHIRIVTAP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.82 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|