C19H16BrClN2O4S — CID 21382312
ethyl 2-[[(E)-3-(5-bromo-3-chloro-2-hydroxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 21382312) has the molecular formula C19H16BrClN2O4S and a molecular weight of 483.77 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(5-bromo-3-chloro-2-hydroxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(5-bromo-3-chloro-2-hydroxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 21382312 |
| Molecular Formula | C19H16BrClN2O4S |
| Molecular Weight | 483.77 g/mol |
| Exact Mass | 481.97 |
| IUPAC Name | ethyl 2-[[(E)-3-(5-bromo-3-chloro-2-hydroxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2cc(Br)cc(Cl)c2O)sc(C)c1C |
| InChI | InChI=1S/C19H16BrClN2O4S/c1-4-27-19(26)15-9(2)10(3)28-18(15)23-17(25)12(8-22)5-11-6-13(20)7-14(21)16(11)24/h5-7,24H,4H2,1-3H3,(H,23,25)/b12-5+ |
| InChIKey | VPUOAHCKYLHUPZ-LFYBBSHMSA-N |
| XLogP | 5.21 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.77 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|