C21H19N3O3S — CID 6067172
ethyl 2-[[(E)-2-cyano-3-(1H-indol-3-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 6067172) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is ethyl 2-[[(E)-2-cyano-3-(1H-indol-3-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-2-cyano-3-(1H-indol-3-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 6067172 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | ethyl 2-[[(E)-2-cyano-3-(1H-indol-3-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2c[nH]c3ccccc23)sc(C)c1C |
| InChI | InChI=1S/C21H19N3O3S/c1-4-27-21(26)18-12(2)13(3)28-20(18)24-19(25)14(10-22)9-15-11-23-17-8-6-5-7-16(15)17/h5-9,11,23H,4H2,1-3H3,(H,24,25)/b14-9+ |
| InChIKey | IPWPGKCXANRYAU-NTEUORMPSA-N |
| XLogP | 4.57 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|