C23H16BrClN2O3S — CID 4281780
ethyl 4-(4-bromophenyl)-2-[[3-(4-chlorophenyl)-2-cyanoprop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 4281780) has the molecular formula C23H16BrClN2O3S and a molecular weight of 515.82 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-2-[[3-(4-chlorophenyl)-2-cyanoprop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-2-[[3-(4-chlorophenyl)-2-cyanoprop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4281780 |
| Molecular Formula | C23H16BrClN2O3S |
| Molecular Weight | 515.82 g/mol |
| Exact Mass | 513.98 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-2-[[3-(4-chlorophenyl)-2-cyanoprop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)C(C#N)=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16BrClN2O3S/c1-2-30-23(29)20-19(15-5-7-17(24)8-6-15)13-31-22(20)27-21(28)16(12-26)11-14-3-9-18(25)10-4-14/h3-11,13H,2H2,1H3,(H,27,28) |
| InChIKey | UTAMRCZEERYKJI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.82 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|