C32H27N3O3S — CID 4575796
ethyl 4-cyano-5-[3-cyano-4-[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate (PubChem CID 4575796) has the molecular formula C32H27N3O3S and a molecular weight of 533.65 g/mol. Its IUPAC name is ethyl 4-cyano-5-[3-cyano-4-[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-5-[3-cyano-4-[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 4575796 |
| Molecular Formula | C32H27N3O3S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | ethyl 4-cyano-5-[3-cyano-4-[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(CC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(-c4ccccc4)cc3)c2C)c(C#N)c1C |
| InChI | InChI=1S/C32H27N3O3S/c1-5-38-32(37)31-21(3)28(19-34)30(39-31)17-29(36)26(18-33)16-25-15-20(2)35(22(25)4)27-13-11-24(12-14-27)23-9-7-6-8-10-23/h6-16H,5,17H2,1-4H3 |
| InChIKey | TZJOVGYCLDKXPT-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 95.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|