C24H18N2O4S2 — CID 4315025
ethyl 4-cyano-5-[3-cyano-2-oxo-4-(5-phenylsulfanylfuran-2-yl)but-3-enyl]-3-methylthiophene-2-carboxylate (PubChem CID 4315025) has the molecular formula C24H18N2O4S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is ethyl 4-cyano-5-[3-cyano-2-oxo-4-(5-phenylsulfanylfuran-2-yl)but-3-enyl]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-5-[3-cyano-2-oxo-4-(5-phenylsulfanylfuran-2-yl)but-3-enyl]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 4315025 |
| Molecular Formula | C24H18N2O4S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | ethyl 4-cyano-5-[3-cyano-2-oxo-4-(5-phenylsulfanylfuran-2-yl)but-3-enyl]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(CC(=O)C(C#N)=Cc2ccc(Sc3ccccc3)o2)c(C#N)c1C |
| InChI | InChI=1S/C24H18N2O4S2/c1-3-29-24(28)23-15(2)19(14-26)21(32-23)12-20(27)16(13-25)11-17-9-10-22(30-17)31-18-7-5-4-6-8-18/h4-11H,3,12H2,1-2H3 |
| InChIKey | NFDVYJXMAZTSLB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 104.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|