C28H23FN2O5S — CID 5207480
ethyl 4-cyano-5-[3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate (PubChem CID 5207480) has the molecular formula C28H23FN2O5S and a molecular weight of 518.57 g/mol. Its IUPAC name is ethyl 4-cyano-5-[3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-5-[3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 5207480 |
| Molecular Formula | C28H23FN2O5S |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | ethyl 4-cyano-5-[3-cyano-4-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(CC(=O)C(C#N)=Cc2ccc(OCc3ccccc3F)c(OC)c2)c(C#N)c1C |
| InChI | InChI=1S/C28H23FN2O5S/c1-4-35-28(33)27-17(2)21(15-31)26(37-27)13-23(32)20(14-30)11-18-9-10-24(25(12-18)34-3)36-16-19-7-5-6-8-22(19)29/h5-12H,4,13,16H2,1-3H3 |
| InChIKey | WPLMYDVXEFTOEO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 109.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|