C26H25N3O6S — CID 124546144
diethyl 5-[(Z)-3-cyano-4-[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 124546144) has the molecular formula C26H25N3O6S and a molecular weight of 507.57 g/mol. Its IUPAC name is diethyl 5-[(Z)-3-cyano-4-[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[(Z)-3-cyano-4-[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 124546144 |
| Molecular Formula | C26H25N3O6S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | diethyl 5-[(Z)-3-cyano-4-[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]-2-oxobut-3-enyl]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(CC(=O)/C(C#N)=C\[C@@H]2C(=O)N(c3ccccc3)N=C2C)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C26H25N3O6S/c1-5-34-25(32)22-15(3)23(26(33)35-6-2)36-21(22)13-20(30)17(14-27)12-19-16(4)28-29(24(19)31)18-10-8-7-9-11-18/h7-12,19H,5-6,13H2,1-4H3/b17-12-/t19-/m0/s1 |
| InChIKey | LAIYIIONQQBFQW-GTVARFKMSA-N |
| XLogP | 4.01 |
| TPSA | 126.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|