C25H23NO6S — CID 3377799
diethyl 5-[3-cyano-2-oxo-4-(4-prop-2-ynoxyphenyl)but-3-enyl]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 3377799) has the molecular formula C25H23NO6S and a molecular weight of 465.53 g/mol. Its IUPAC name is diethyl 5-[3-cyano-2-oxo-4-(4-prop-2-ynoxyphenyl)but-3-enyl]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[3-cyano-2-oxo-4-(4-prop-2-ynoxyphenyl)but-3-enyl]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3377799 |
| Molecular Formula | C25H23NO6S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | diethyl 5-[3-cyano-2-oxo-4-(4-prop-2-ynoxyphenyl)but-3-enyl]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | C#CCOc1ccc(C=C(C#N)C(=O)Cc2sc(C(=O)OCC)c(C)c2C(=O)OCC)cc1 |
| InChI | InChI=1S/C25H23NO6S/c1-5-12-32-19-10-8-17(9-11-19)13-18(15-26)20(27)14-21-22(24(28)30-6-2)16(4)23(33-21)25(29)31-7-3/h1,8-11,13H,6-7,12,14H2,2-4H3 |
| InChIKey | HXWYMWWPTGLYRC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|