C23H17N3O2S2 — CID 21382691
(E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(5-phenylsulfanylfuran-2-yl)prop-2-enamide (PubChem CID 21382691) has the molecular formula C23H17N3O2S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(5-phenylsulfanylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(5-phenylsulfanylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 21382691 |
| Molecular Formula | C23H17N3O2S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(5-phenylsulfanylfuran-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(Sc2ccccc2)o1)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C23H17N3O2S2/c24-13-15(12-16-10-11-21(28-16)29-17-6-2-1-3-7-17)22(27)26-23-19(14-25)18-8-4-5-9-20(18)30-23/h1-3,6-7,10-12H,4-5,8-9H2,(H,26,27)/b15-12+ |
| InChIKey | NMUGKRFOHDMBLK-NTCAYCPXSA-N |
| XLogP | 5.79 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|