C23H14Cl2N4O4S — CID 21382694
(E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 21382694) has the molecular formula C23H14Cl2N4O4S and a molecular weight of 513.36 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 21382694 |
| Molecular Formula | C23H14Cl2N4O4S |
| Molecular Weight | 513.36 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-c2cc(Cl)c([N+](=O)[O-])cc2Cl)o1)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C23H14Cl2N4O4S/c24-17-9-19(29(31)32)18(25)8-15(17)20-6-5-13(33-20)7-12(10-26)22(30)28-23-16(11-27)14-3-1-2-4-21(14)34-23/h5-9H,1-4H2,(H,28,30)/b12-7+ |
| InChIKey | LZMVHOSEMUFEOS-KPKJPENVSA-N |
| XLogP | 6.52 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.36 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|