C27H24ClN3O6S — CID 3305430
butyl 2-[[3-[5-(4-chloro-3-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3305430) has the molecular formula C27H24ClN3O6S and a molecular weight of 554.02 g/mol. Its IUPAC name is butyl 2-[[3-[5-(4-chloro-3-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-[[3-[5-(4-chloro-3-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3305430 |
| Molecular Formula | C27H24ClN3O6S |
| Molecular Weight | 554.02 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | butyl 2-[[3-[5-(4-chloro-3-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)C(C#N)=Cc2ccc(-c3ccc(Cl)c([N+](=O)[O-])c3)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C27H24ClN3O6S/c1-2-3-12-36-27(33)24-19-6-4-5-7-23(19)38-26(24)30-25(32)17(15-29)13-18-9-11-22(37-18)16-8-10-20(28)21(14-16)31(34)35/h8-11,13-14H,2-7,12H2,1H3,(H,30,32) |
| InChIKey | JYWKEWCGPNSEFA-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 135.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.02 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|