C27H23ClN2O6S — CID 21381317
ethyl 2-[[(Z)-3-[5-(5-chloro-2-methoxycarbonylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 21381317) has the molecular formula C27H23ClN2O6S and a molecular weight of 539.01 g/mol. Its IUPAC name is ethyl 2-[[(Z)-3-[5-(5-chloro-2-methoxycarbonylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(Z)-3-[5-(5-chloro-2-methoxycarbonylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 21381317 |
| Molecular Formula | C27H23ClN2O6S |
| Molecular Weight | 539.01 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | ethyl 2-[[(Z)-3-[5-(5-chloro-2-methoxycarbonylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C\c2ccc(-c3cc(Cl)ccc3C(=O)OC)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C27H23ClN2O6S/c1-3-35-27(33)23-19-6-4-5-7-22(19)37-25(23)30-24(31)15(14-29)12-17-9-11-21(36-17)20-13-16(28)8-10-18(20)26(32)34-2/h8-13H,3-7H2,1-2H3,(H,30,31)/b15-12- |
| InChIKey | QYILICDBRAJDOU-QINSGFPZSA-N |
| XLogP | 6.05 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.01 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|