C24H16N4O2S3 — CID 21382693
(E)-3-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide (PubChem CID 21382693) has the molecular formula C24H16N4O2S3 and a molecular weight of 488.62 g/mol. Its IUPAC name is (E)-3-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 21382693 |
| Molecular Formula | C24H16N4O2S3 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | (E)-3-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(Sc2nc3ccccc3s2)o1)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C24H16N4O2S3/c25-12-14(22(29)28-23-17(13-26)16-5-1-3-7-19(16)31-23)11-15-9-10-21(30-15)33-24-27-18-6-2-4-8-20(18)32-24/h2,4,6,8-11H,1,3,5,7H2,(H,28,29)/b14-11+ |
| InChIKey | YIVUHEZAVQNJTJ-SDNWHVSQSA-N |
| XLogP | 6.40 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|