C17H11BrIN3O2S — CID 21382738
(E)-3-(4-bromo-5-iodofuran-2-yl)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide (PubChem CID 21382738) has the molecular formula C17H11BrIN3O2S and a molecular weight of 528.17 g/mol. Its IUPAC name is (E)-3-(4-bromo-5-iodofuran-2-yl)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-bromo-5-iodofuran-2-yl)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 21382738 |
| Molecular Formula | C17H11BrIN3O2S |
| Molecular Weight | 528.17 g/mol |
| Exact Mass | 526.88 |
| IUPAC Name | (E)-3-(4-bromo-5-iodofuran-2-yl)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Br)c(I)o1)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C17H11BrIN3O2S/c18-13-6-10(24-15(13)19)5-9(7-20)16(23)22-17-12(8-21)11-3-1-2-4-14(11)25-17/h5-6H,1-4H2,(H,22,23)/b9-5+ |
| InChIKey | PPVIWVQTEVCCPV-WEVVVXLNSA-N |
| XLogP | 5.00 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.17 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|