C20H16BrN3O3S — CID 6140877
(E)-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide (PubChem CID 6140877) has the molecular formula C20H16BrN3O3S and a molecular weight of 458.34 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6140877 |
| Molecular Formula | C20H16BrN3O3S |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | (E)-3-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
| SMILES | COc1cc(Br)cc(/C=C(\C#N)C(=O)Nc2sc3c(c2C#N)CCCC3)c1O |
| InChI | InChI=1S/C20H16BrN3O3S/c1-27-16-8-13(21)7-11(18(16)25)6-12(9-22)19(26)24-20-15(10-23)14-4-2-3-5-17(14)28-20/h6-8,25H,2-5H2,1H3,(H,24,26)/b12-6+ |
| InChIKey | JBRQPPWPKMEBPP-WUXMJOGZSA-N |
| XLogP | 4.52 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|