C27H22BrN3O2S — CID 21382703
(E)-3-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide (PubChem CID 21382703) has the molecular formula C27H22BrN3O2S and a molecular weight of 532.46 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 21382703 |
| Molecular Formula | C27H22BrN3O2S |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | (E)-3-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(COc2ccc(Br)cc2/C=C(\C#N)C(=O)Nc2sc3c(c2C#N)CCCC3)cc1 |
| InChI | InChI=1S/C27H22BrN3O2S/c1-17-6-8-18(9-7-17)16-33-24-11-10-21(28)13-19(24)12-20(14-29)26(32)31-27-23(15-30)22-4-2-3-5-25(22)34-27/h6-13H,2-5,16H2,1H3,(H,31,32)/b20-12+ |
| InChIKey | LJZUFARCYXRMAG-UDWIEESQSA-N |
| XLogP | 6.69 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|