C26H19BrFN3O2S — CID 124540862
(E)-3-[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide (PubChem CID 124540862) has the molecular formula C26H19BrFN3O2S and a molecular weight of 536.43 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 124540862 |
| Molecular Formula | C26H19BrFN3O2S |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | (E)-3-[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Br)ccc1OCc1ccccc1F)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C26H19BrFN3O2S/c27-19-9-10-23(33-15-16-5-1-3-7-22(16)28)17(12-19)11-18(13-29)25(32)31-26-21(14-30)20-6-2-4-8-24(20)34-26/h1,3,5,7,9-12H,2,4,6,8,15H2,(H,31,32)/b18-11+ |
| InChIKey | AMZYQJPVNQKDQZ-WOJGMQOQSA-N |
| XLogP | 6.52 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|