C32H27FN2O4S — CID 6252763
ethyl 2-[[(E)-2-cyano-3-[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 6252763) has the molecular formula C32H27FN2O4S and a molecular weight of 554.64 g/mol. Its IUPAC name is ethyl 2-[[(E)-2-cyano-3-[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-2-cyano-3-[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 6252763 |
| Molecular Formula | C32H27FN2O4S |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | ethyl 2-[[(E)-2-cyano-3-[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2c(OCc3ccccc3F)ccc3ccccc23)sc2c1CCCC2 |
| InChI | InChI=1S/C32H27FN2O4S/c1-2-38-32(37)29-24-12-6-8-14-28(24)40-31(29)35-30(36)22(18-34)17-25-23-11-5-3-9-20(23)15-16-27(25)39-19-21-10-4-7-13-26(21)33/h3-5,7,9-11,13,15-17H,2,6,8,12,14,19H2,1H3,(H,35,36)/b22-17+ |
| InChIKey | NRKMVMWAZLUCFO-OQKWZONESA-N |
| XLogP | 7.22 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|