C28H25FN2O4S — CID 3917540
ethyl 2-[[2-cyano-3-[2-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3917540) has the molecular formula C28H25FN2O4S and a molecular weight of 504.58 g/mol. Its IUPAC name is ethyl 2-[[2-cyano-3-[2-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-cyano-3-[2-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3917540 |
| Molecular Formula | C28H25FN2O4S |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | ethyl 2-[[2-cyano-3-[2-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C#N)=Cc2ccccc2OCc2ccccc2F)sc2c1CCCC2 |
| InChI | InChI=1S/C28H25FN2O4S/c1-2-34-28(33)25-21-11-5-8-14-24(21)36-27(25)31-26(32)20(16-30)15-18-9-4-7-13-23(18)35-17-19-10-3-6-12-22(19)29/h3-4,6-7,9-10,12-13,15H,2,5,8,11,14,17H2,1H3,(H,31,32) |
| InChIKey | SFWMZRABCWAQKJ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|