C29H24BrN3O4S — CID 5216814
ethyl 2-[[3-[5-bromo-2-[(2-cyanophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5216814) has the molecular formula C29H24BrN3O4S and a molecular weight of 590.50 g/mol. Its IUPAC name is ethyl 2-[[3-[5-bromo-2-[(2-cyanophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3-[5-bromo-2-[(2-cyanophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5216814 |
| Molecular Formula | C29H24BrN3O4S |
| Molecular Weight | 590.50 g/mol |
| Exact Mass | 589.07 |
| IUPAC Name | ethyl 2-[[3-[5-bromo-2-[(2-cyanophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C#N)=Cc2cc(Br)ccc2OCc2ccccc2C#N)sc2c1CCCC2 |
| InChI | InChI=1S/C29H24BrN3O4S/c1-2-36-29(35)26-23-9-5-6-10-25(23)38-28(26)33-27(34)21(16-32)13-20-14-22(30)11-12-24(20)37-17-19-8-4-3-7-18(19)15-31/h3-4,7-8,11-14H,2,5-6,9-10,17H2,1H3,(H,33,34) |
| InChIKey | NSPKMYSZQBEAGD-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.50 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|