C31H27Cl2N3O3S — CID 3906574
ethyl 2-[[2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3906574) has the molecular formula C31H27Cl2N3O3S and a molecular weight of 592.55 g/mol. Its IUPAC name is ethyl 2-[[2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3906574 |
| Molecular Formula | C31H27Cl2N3O3S |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | ethyl 2-[[2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C#N)=Cc2c(C)n(Cc3ccc(Cl)cc3Cl)c3ccccc23)sc2c1CCCC2 |
| InChI | InChI=1S/C31H27Cl2N3O3S/c1-3-39-31(38)28-23-9-5-7-11-27(23)40-30(28)35-29(37)20(16-34)14-24-18(2)36(26-10-6-4-8-22(24)26)17-19-12-13-21(32)15-25(19)33/h4,6,8,10,12-15H,3,5,7,9,11,17H2,1-2H3,(H,35,37) |
| InChIKey | WTEZTHFXTXPOSG-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|