C32H27N3O3S — CID 21382616
(E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 21382616) has the molecular formula C32H27N3O3S and a molecular weight of 533.65 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 21382616 |
| Molecular Formula | C32H27N3O3S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2sc3c(c2C#N)CCCC3)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C32H27N3O3S/c1-2-37-29-17-21(14-15-28(29)38-20-23-10-7-9-22-8-3-4-11-25(22)23)16-24(18-33)31(36)35-32-27(19-34)26-12-5-6-13-30(26)39-32/h3-4,7-11,14-17H,2,5-6,12-13,20H2,1H3,(H,35,36)/b24-16+ |
| InChIKey | ZFEGBRSJECWPAX-LFVJCYFKSA-N |
| XLogP | 7.18 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|