C27H22N4O5S — CID 21382613
(E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 21382613) has the molecular formula C27H22N4O5S and a molecular weight of 514.56 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 21382613 |
| Molecular Formula | C27H22N4O5S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2sc3c(c2C#N)CCCC3)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H22N4O5S/c1-35-23-12-18(22(31(33)34)13-24(23)36-16-17-7-3-2-4-8-17)11-19(14-28)26(32)30-27-21(15-29)20-9-5-6-10-25(20)37-27/h2-4,7-8,11-13H,5-6,9-10,16H2,1H3,(H,30,32)/b19-11+ |
| InChIKey | ICVFAVIHTROMMA-YBFXNURJSA-N |
| XLogP | 5.54 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|