C19H19N3O5S — CID 55394029
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-5-ethoxy-4-methoxy-2-nitrobenzamide (PubChem CID 55394029) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-5-ethoxy-4-methoxy-2-nitrobenzamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-5-ethoxy-4-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55394029 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-5-ethoxy-4-methoxy-2-nitrobenzamide |
| SMILES | CCOc1cc(C(=O)Nc2sc3c(c2C#N)CCCC3)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H19N3O5S/c1-3-27-16-8-12(14(22(24)25)9-15(16)26-2)18(23)21-19-13(10-20)11-6-4-5-7-17(11)28-19/h8-9H,3-7H2,1-2H3,(H,21,23) |
| InChIKey | JUKMTYRIKCLGGM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|