C22H21N3O6S — CID 55572450
2-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-5-methyl-4-phenylthiophene-3-carboxamide (PubChem CID 55572450) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is 2-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-5-methyl-4-phenylthiophene-3-carboxamide.
| Compound Name | 2-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-5-methyl-4-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 55572450 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 2-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-5-methyl-4-phenylthiophene-3-carboxamide |
| SMILES | CCOc1cc(C(=O)Nc2sc(C)c(-c3ccccc3)c2C(N)=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C22H21N3O6S/c1-4-31-17-10-14(15(25(28)29)11-16(17)30-3)21(27)24-22-19(20(23)26)18(12(2)32-22)13-8-6-5-7-9-13/h5-11H,4H2,1-3H3,(H2,23,26)(H,24,27) |
| InChIKey | OITVNILBOXGRNX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|