C27H21N5O4S2 — CID 21381280
(Z)-3-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide (PubChem CID 21381280) has the molecular formula C27H21N5O4S2 and a molecular weight of 543.63 g/mol. Its IUPAC name is (Z)-3-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 21381280 |
| Molecular Formula | C27H21N5O4S2 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | (Z)-3-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
| SMILES | CC(=O)Nc1ccccc1Sc1ccc(/C=C(/C#N)C(=O)Nc2sc3c(c2C#N)CCCC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H21N5O4S2/c1-16(33)30-21-7-3-5-9-24(21)37-25-11-10-17(13-22(25)32(35)36)12-18(14-28)26(34)31-27-20(15-29)19-6-2-4-8-23(19)38-27/h3,5,7,9-13H,2,4,6,8H2,1H3,(H,30,33)(H,31,34)/b18-12- |
| InChIKey | WTXKZQXSXQONIA-PDGQHHTCSA-N |
| XLogP | 6.06 |
| TPSA | 148.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|