C25H20N6O3S2 — CID 21381282
(Z)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]prop-2-enamide (PubChem CID 21381282) has the molecular formula C25H20N6O3S2 and a molecular weight of 516.61 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 21381282 |
| Molecular Formula | C25H20N6O3S2 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | (Z)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]prop-2-enamide |
| SMILES | Cc1cc(C)nc(Sc2ccc(/C=C(/C#N)C(=O)Nc3sc4c(c3C#N)CCCC4)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C25H20N6O3S2/c1-14-9-15(2)29-25(28-14)36-22-8-7-16(11-20(22)31(33)34)10-17(12-26)23(32)30-24-19(13-27)18-5-3-4-6-21(18)35-24/h7-11H,3-6H2,1-2H3,(H,30,32)/b17-10- |
| InChIKey | AZQUHGIKTFOLBM-YVLHZVERSA-N |
| XLogP | 5.51 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|