C24H20N4O3S2 — CID 126115988
N-[2-[4-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]-2-nitrophenyl]sulfanylphenyl]acetamide (PubChem CID 126115988) has the molecular formula C24H20N4O3S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[2-[4-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]-2-nitrophenyl]sulfanylphenyl]acetamide.
| Compound Name | N-[2-[4-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]-2-nitrophenyl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 126115988 |
| Molecular Formula | C24H20N4O3S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | N-[2-[4-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]-2-nitrophenyl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1Sc1ccc(C=Nc2sc3c(c2C#N)CCCC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H20N4O3S2/c1-15(29)27-19-7-3-5-9-22(19)32-23-11-10-16(12-20(23)28(30)31)14-26-24-18(13-25)17-6-2-4-8-21(17)33-24/h3,5,7,9-12,14H,2,4,6,8H2,1H3,(H,27,29) |
| InChIKey | IXOYJJLQYZTFSC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|