C24H22N4O6S — CID 4550666
N-[[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3,5-dimethoxybenzamide (PubChem CID 4550666) has the molecular formula C24H22N4O6S and a molecular weight of 494.53 g/mol. Its IUPAC name is N-[[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3,5-dimethoxybenzamide.
| Compound Name | N-[[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 4550666 |
| Molecular Formula | C24H22N4O6S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | N-[[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NN=Cc2ccc(Sc3ccccc3NC(C)=O)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H22N4O6S/c1-15(29)26-20-6-4-5-7-22(20)35-23-9-8-16(10-21(23)28(31)32)14-25-27-24(30)17-11-18(33-2)13-19(12-17)34-3/h4-14H,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | YLUQCZUCLMYGQB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|