C22H16Cl2N4O4S — CID 126126526
N-[(E)-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dichlorobenzamide (PubChem CID 126126526) has the molecular formula C22H16Cl2N4O4S and a molecular weight of 503.37 g/mol. Its IUPAC name is N-[(E)-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dichlorobenzamide.
| Compound Name | N-[(E)-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 126126526 |
| Molecular Formula | C22H16Cl2N4O4S |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | N-[(E)-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dichlorobenzamide |
| SMILES | CC(=O)Nc1ccccc1Sc1ccc(/C=N/NC(=O)c2ccc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16Cl2N4O4S/c1-13(29)26-18-4-2-3-5-20(18)33-21-9-6-14(10-19(21)28(31)32)12-25-27-22(30)16-8-7-15(23)11-17(16)24/h2-12H,1H3,(H,26,29)(H,27,30)/b25-12+ |
| InChIKey | VBMVFLGPZOYJEP-BRJLIKDPSA-N |
| XLogP | 5.78 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|