C24H21N5O5S — CID 124551903
4-acetamido-N-[(E)-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzamide (PubChem CID 124551903) has the molecular formula C24H21N5O5S and a molecular weight of 491.53 g/mol. Its IUPAC name is 4-acetamido-N-[(E)-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzamide.
| Compound Name | 4-acetamido-N-[(E)-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 124551903 |
| Molecular Formula | C24H21N5O5S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 4-acetamido-N-[(E)-[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)N/N=C/c2ccc(Sc3ccccc3NC(C)=O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H21N5O5S/c1-15(30)26-19-10-8-18(9-11-19)24(32)28-25-14-17-7-12-23(21(13-17)29(33)34)35-22-6-4-3-5-20(22)27-16(2)31/h3-14H,1-2H3,(H,26,30)(H,27,31)(H,28,32)/b25-14+ |
| InChIKey | LJRQJNBATYZEMZ-AFUMVMLFSA-N |
| XLogP | 4.43 |
| TPSA | 142.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|