C23H19N3O5S — CID 126127007
methyl 4-[[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzoate (PubChem CID 126127007) has the molecular formula C23H19N3O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is methyl 4-[[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzoate.
| Compound Name | methyl 4-[[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 126127007 |
| Molecular Formula | C23H19N3O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | methyl 4-[[4-(2-acetamidophenyl)sulfanyl-3-nitrophenyl]methylideneamino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C/c2ccc(Sc3ccccc3NC(C)=O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H19N3O5S/c1-15(27)25-19-5-3-4-6-21(19)32-22-12-7-16(13-20(22)26(29)30)14-24-18-10-8-17(9-11-18)23(28)31-2/h3-14H,1-2H3,(H,25,27)/b24-14+ |
| InChIKey | VSVQRYGKDSRMSV-ZVHZXABRSA-N |
| XLogP | 5.24 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|