C20H17N5O5S — CID 4646980
3,5-dimethoxy-N-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]benzamide (PubChem CID 4646980) has the molecular formula C20H17N5O5S and a molecular weight of 439.45 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]benzamide.
| Compound Name | 3,5-dimethoxy-N-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4646980 |
| Molecular Formula | C20H17N5O5S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 3,5-dimethoxy-N-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NN=Cc2ccc(Sc3ncccn3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H17N5O5S/c1-29-15-9-14(10-16(11-15)30-2)19(26)24-23-12-13-4-5-18(17(8-13)25(27)28)31-20-21-6-3-7-22-20/h3-12H,1-2H3,(H,24,26) |
| InChIKey | WNEDLPJFLKXKAA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|