C28H26N6O2S2 — CID 98108639
(6R)-6-tert-butyl-2-[[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 98108639) has the molecular formula C28H26N6O2S2 and a molecular weight of 542.69 g/mol. Its IUPAC name is (6R)-6-tert-butyl-2-[[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6R)-6-tert-butyl-2-[[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 98108639 |
| Molecular Formula | C28H26N6O2S2 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | (6R)-6-tert-butyl-2-[[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(N=Cc3ccc(Sc4n[nH]c(-c5ccccc5)n4)c([N+](=O)[O-])c3)c2C#N)C1 |
| InChI | InChI=1S/C28H26N6O2S2/c1-28(2,3)19-10-11-20-21(15-29)26(37-24(20)14-19)30-16-17-9-12-23(22(13-17)34(35)36)38-27-31-25(32-33-27)18-7-5-4-6-8-18/h4-9,12-13,16,19H,10-11,14H2,1-3H3,(H,31,32,33)/t19-/m1/s1 |
| InChIKey | QXCIZQFDAXFZIL-LJQANCHMSA-N |
| XLogP | 7.37 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|