C16H14ClN3O3S — CID 50883739
2-[(4-chloro-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 50883739) has the molecular formula C16H14ClN3O3S and a molecular weight of 363.83 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 50883739 |
| Molecular Formula | C16H14ClN3O3S |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(N=Cc2ccc(Cl)c([N+](=O)[O-])c2)sc2c1CCCC2 |
| InChI | InChI=1S/C16H14ClN3O3S/c17-11-6-5-9(7-12(11)20(22)23)8-19-16-14(15(18)21)10-3-1-2-4-13(10)24-16/h5-8H,1-4H2,(H2,18,21) |
| InChIKey | IHXWHYVCZLSMCW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 98.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|