C16H17N4O3S+ — CID 6944680
6-methyl-2-[(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide (PubChem CID 6944680) has the molecular formula C16H17N4O3S+ and a molecular weight of 345.40 g/mol. Its IUPAC name is 6-methyl-2-[(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide.
| Compound Name | 6-methyl-2-[(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
|---|---|
| PubChem CID | 6944680 |
| Molecular Formula | C16H17N4O3S+ |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 6-methyl-2-[(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
| SMILES | C[NH+]1CCc2c(sc(N=Cc3cccc([N+](=O)[O-])c3)c2C(N)=O)C1 |
| InChI | InChI=1S/C16H16N4O3S/c1-19-6-5-12-13(9-19)24-16(14(12)15(17)21)18-8-10-3-2-4-11(7-10)20(22)23/h2-4,7-8H,5-6,9H2,1H3,(H2,17,21)/p+1 |
| InChIKey | JZXLDHQIXRDTHP-UHFFFAOYSA-O |
| XLogP | 1.08 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|