C17H16I2N2O3S — CID 5123224
2,4-diiodo-6-[(3-methoxycarbonyl-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl)iminomethyl]phenolate (PubChem CID 5123224) has the molecular formula C17H16I2N2O3S and a molecular weight of 582.20 g/mol. Its IUPAC name is 2,4-diiodo-6-[(3-methoxycarbonyl-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl)iminomethyl]phenolate.
| Compound Name | 2,4-diiodo-6-[(3-methoxycarbonyl-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl)iminomethyl]phenolate |
|---|---|
| PubChem CID | 5123224 |
| Molecular Formula | C17H16I2N2O3S |
| Molecular Weight | 582.20 g/mol |
| Exact Mass | 581.90 |
| IUPAC Name | 2,4-diiodo-6-[(3-methoxycarbonyl-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl)iminomethyl]phenolate |
| SMILES | COC(=O)c1c(N=Cc2cc(I)cc(I)c2[O-])sc2c1CC[NH+](C)C2 |
| InChI | InChI=1S/C17H16I2N2O3S/c1-21-4-3-11-13(8-21)25-16(14(11)17(23)24-2)20-7-9-5-10(18)6-12(19)15(9)22/h5-7,22H,3-4,8H2,1-2H3 |
| InChIKey | VUMUNDCMRAOKKO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|