C18H17I2NO3S — CID 136914502
ethyl 2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 136914502) has the molecular formula C18H17I2NO3S and a molecular weight of 581.21 g/mol. Its IUPAC name is ethyl 2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 136914502 |
| Molecular Formula | C18H17I2NO3S |
| Molecular Weight | 581.21 g/mol |
| Exact Mass | 580.90 |
| IUPAC Name | ethyl 2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N=Cc2cc(I)cc(I)c2O)sc2c1CCCC2 |
| InChI | InChI=1S/C18H17I2NO3S/c1-2-24-18(23)15-12-5-3-4-6-14(12)25-17(15)21-9-10-7-11(19)8-13(20)16(10)22/h7-9,22H,2-6H2,1H3 |
| InChIKey | OKORXSZPFRIHPP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.21 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|