C25H22F3N3O3S — CID 135536542
ethyl 2-[(E)-[2-hydroxy-5-[[3-(trifluoromethyl)phenyl]diazenyl]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 135536542) has the molecular formula C25H22F3N3O3S and a molecular weight of 501.53 g/mol. Its IUPAC name is ethyl 2-[(E)-[2-hydroxy-5-[[3-(trifluoromethyl)phenyl]diazenyl]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(E)-[2-hydroxy-5-[[3-(trifluoromethyl)phenyl]diazenyl]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135536542 |
| Molecular Formula | C25H22F3N3O3S |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | ethyl 2-[(E)-[2-hydroxy-5-[[3-(trifluoromethyl)phenyl]diazenyl]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(/N=C/c2cc(/N=N/c3cccc(C(F)(F)F)c3)ccc2O)sc2c1CCCC2 |
| InChI | InChI=1S/C25H22F3N3O3S/c1-2-34-24(33)22-19-8-3-4-9-21(19)35-23(22)29-14-15-12-18(10-11-20(15)32)31-30-17-7-5-6-16(13-17)25(26,27)28/h5-7,10-14,32H,2-4,8-9H2,1H3/b29-14+,31-30+ |
| InChIKey | AAKUPRLNKIOVQK-LPNUPUKZSA-N |
| XLogP | 7.69 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|