C18H18CuN2O6S — CID 11655397
copper;2-[(E)-(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]phenolate;nitrate (PubChem CID 11655397) has the molecular formula C18H18CuN2O6S and a molecular weight of 453.96 g/mol. Its IUPAC name is copper;2-[(E)-(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]phenolate;nitrate.
| Compound Name | copper;2-[(E)-(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]phenolate;nitrate |
|---|---|
| PubChem CID | 11655397 |
| Molecular Formula | C18H18CuN2O6S |
| Molecular Weight | 453.96 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | copper;2-[(E)-(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]phenolate;nitrate |
| SMILES | CCOC(=O)c1c(/N=C/c2ccccc2[O-])sc2c1CCCC2.O=[N+]([O-])[O-].[Cu+2] |
| InChI | InChI=1S/C18H19NO3S.Cu.NO3/c1-2-22-18(21)16-13-8-4-6-10-15(13)23-17(16)19-11-12-7-3-5-9-14(12)20;;2-1(3)4/h3,5,7,9,11,20H,2,4,6,8,10H2,1H3;;/q;+2;-1/p-1/b19-11+;; |
| InChIKey | YQKJQJAQNCUCGN-KRYQRJNDSA-M |
| XLogP | 3.39 |
| TPSA | 127.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.96 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|