C18H17N2O5S- — CID 7121548
4-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]-2-nitrophenolate (PubChem CID 7121548) has the molecular formula C18H17N2O5S- and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]-2-nitrophenolate.
| Compound Name | 4-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 7121548 |
| Molecular Formula | C18H17N2O5S- |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 4-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]-2-nitrophenolate |
| SMILES | CCOC(=O)c1c(N=Cc2ccc([O-])c([N+](=O)[O-])c2)sc2c1CCCC2 |
| InChI | InChI=1S/C18H18N2O5S/c1-2-25-18(22)16-12-5-3-4-6-15(12)26-17(16)19-10-11-7-8-14(21)13(9-11)20(23)24/h7-10,21H,2-6H2,1H3/p-1 |
| InChIKey | ICSGFGVJPAZMRV-UHFFFAOYSA-M |
| XLogP | 3.54 |
| TPSA | 104.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|