C26H26N2O2S — CID 23880389
ethyl 2-[(9-ethylcarbazol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 23880389) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is ethyl 2-[(9-ethylcarbazol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(9-ethylcarbazol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23880389 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | ethyl 2-[(9-ethylcarbazol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N=Cc2ccc3c(c2)c2ccccc2n3CC)sc2c1CCCC2 |
| InChI | InChI=1S/C26H26N2O2S/c1-3-28-21-11-7-5-9-18(21)20-15-17(13-14-22(20)28)16-27-25-24(26(29)30-4-2)19-10-6-8-12-23(19)31-25/h5,7,9,11,13-16H,3-4,6,8,10,12H2,1-2H3 |
| InChIKey | IQWGKELOSXOKEB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|