C25H24N2O2S — CID 23739315
methyl 2-[(9-ethylcarbazol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 23739315) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is methyl 2-[(9-ethylcarbazol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(9-ethylcarbazol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23739315 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | methyl 2-[(9-ethylcarbazol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCn1c2ccccc2c2cc(C=Nc3sc4c(c3C(=O)OC)CCCC4)ccc21 |
| InChI | InChI=1S/C25H24N2O2S/c1-3-27-20-10-6-4-8-17(20)19-14-16(12-13-21(19)27)15-26-24-23(25(28)29-2)18-9-5-7-11-22(18)30-24/h4,6,8,10,12-15H,3,5,7,9,11H2,1-2H3 |
| InChIKey | MBCXPENUUBNKKH-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|